C16H30Si — CID 10092051
2-[(1R,2R)-1-(2,2-dimethylpropyl)-2-methylcyclopentyl]ethynyl-trimethylsilane (PubChem CID 10092051) has the molecular formula C16H30Si and a molecular weight of 250.50 g/mol. Its IUPAC name is 2-[(1R,2R)-1-(2,2-dimethylpropyl)-2-methylcyclopentyl]ethynyl-trimethylsilane.
| Compound Name | 2-[(1R,2R)-1-(2,2-dimethylpropyl)-2-methylcyclopentyl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10092051 |
| Molecular Formula | C16H30Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | 2-[(1R,2R)-1-(2,2-dimethylpropyl)-2-methylcyclopentyl]ethynyl-trimethylsilane |
| SMILES | C[C@@H]1CCC[C@@]1(C#C[Si](C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C16H30Si/c1-14-9-8-10-16(14,13-15(2,3)4)11-12-17(5,6)7/h14H,8-10,13H2,1-7H3/t14-,16-/m1/s1 |
| InChIKey | OCPFLNFOEAZAAG-GDBMZVCRSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|