C16H30OSi — CID 10445662
2,3-dimethylbutan-2-yl-[(1R,2R)-1-ethynyl-2-methylcyclopentyl]oxy-dimethylsilane (PubChem CID 10445662) has the molecular formula C16H30OSi and a molecular weight of 266.50 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl-[(1R,2R)-1-ethynyl-2-methylcyclopentyl]oxy-dimethylsilane.
| Compound Name | 2,3-dimethylbutan-2-yl-[(1R,2R)-1-ethynyl-2-methylcyclopentyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10445662 |
| Molecular Formula | C16H30OSi |
| Molecular Weight | 266.50 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 2,3-dimethylbutan-2-yl-[(1R,2R)-1-ethynyl-2-methylcyclopentyl]oxy-dimethylsilane |
| SMILES | C#C[C@@]1(O[Si](C)(C)C(C)(C)C(C)C)CCC[C@H]1C |
| InChI | InChI=1S/C16H30OSi/c1-9-16(12-10-11-14(16)4)17-18(7,8)15(5,6)13(2)3/h1,13-14H,10-12H2,2-8H3/t14-,16-/m1/s1 |
| InChIKey | LUMAKYHGVGUOKC-GDBMZVCRSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.50 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|