C25H29FN2O4 — CID 100683391
4-(4-fluorophenyl)-N-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]oxane-4-carboxamide (PubChem CID 100683391) has the molecular formula C25H29FN2O4 and a molecular weight of 440.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]oxane-4-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 100683391 |
| Molecular Formula | C25H29FN2O4 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]oxane-4-carboxamide |
| SMILES | O=C(COc1ccc(NC(=O)C2(c3ccc(F)cc3)CCOCC2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H29FN2O4/c26-20-6-4-19(5-7-20)25(12-16-31-17-13-25)24(30)27-21-8-10-22(11-9-21)32-18-23(29)28-14-2-1-3-15-28/h4-11H,1-3,12-18H2,(H,27,30) |
| InChIKey | GDDUPEVGJYKKPP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |