C16H21N3O2 — CID 100684548
N-[4-[[(1R,3S)-3-cyanocyclohexyl]amino]-3-methoxyphenyl]acetamide (PubChem CID 100684548) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[4-[[(1R,3S)-3-cyanocyclohexyl]amino]-3-methoxyphenyl]acetamide.
| Compound Name | N-[4-[[(1R,3S)-3-cyanocyclohexyl]amino]-3-methoxyphenyl]acetamide |
|---|---|
| PubChem CID | 100684548 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[4-[[(1R,3S)-3-cyanocyclohexyl]amino]-3-methoxyphenyl]acetamide |
| SMILES | COc1cc(NC(C)=O)ccc1N[C@@H]1CCC[C@H](C#N)C1 |
| InChI | InChI=1S/C16H21N3O2/c1-11(20)18-14-6-7-15(16(9-14)21-2)19-13-5-3-4-12(8-13)10-17/h6-7,9,12-13,19H,3-5,8H2,1-2H3,(H,18,20)/t12-,13+/m0/s1 |
| InChIKey | GLLMNFPOBJLORP-QWHCGFSZSA-N |
| XLogP | 3.15 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |