C18H24N4O2 — CID 138472629
(2S)-5-amino-6-[[(1S,3S)-3-cyanocyclohexyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylic acid (PubChem CID 138472629) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2S)-5-amino-6-[[(1S,3S)-3-cyanocyclohexyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylic acid.
| Compound Name | (2S)-5-amino-6-[[(1S,3S)-3-cyanocyclohexyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 138472629 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (2S)-5-amino-6-[[(1S,3S)-3-cyanocyclohexyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylic acid |
| SMILES | C[C@H]1CCc2c(ccc(N[C@H]3CCC[C@H](C#N)C3)c2N)N1C(=O)O |
| InChI | InChI=1S/C18H24N4O2/c1-11-5-6-14-16(22(11)18(23)24)8-7-15(17(14)20)21-13-4-2-3-12(9-13)10-19/h7-8,11-13,21H,2-6,9,20H2,1H3,(H,23,24)/t11-,12-,13-/m0/s1 |
| InChIKey | VGSCYINIFVBKTH-AVGNSLFASA-N |
| XLogP | 3.58 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|