C15H18N2O — CID 70845921
N-[(1R,3S)-3-cyanocyclohexyl]-2-methylbenzamide (PubChem CID 70845921) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-[(1R,3S)-3-cyanocyclohexyl]-2-methylbenzamide.
| Compound Name | N-[(1R,3S)-3-cyanocyclohexyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 70845921 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-[(1R,3S)-3-cyanocyclohexyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)N[C@@H]1CCC[C@H](C#N)C1 |
| InChI | InChI=1S/C15H18N2O/c1-11-5-2-3-8-14(11)15(18)17-13-7-4-6-12(9-13)10-16/h2-3,5,8,12-13H,4,6-7,9H2,1H3,(H,17,18)/t12-,13+/m0/s1 |
| InChIKey | XNQYOGLEGGLHNA-QWHCGFSZSA-N |
| XLogP | 2.81 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |