C15H18N2O2 — CID 99777899
N-[(1R,3R)-3-cyanocyclopentyl]-2-methoxy-5-methylbenzamide (PubChem CID 99777899) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is N-[(1R,3R)-3-cyanocyclopentyl]-2-methoxy-5-methylbenzamide.
| Compound Name | N-[(1R,3R)-3-cyanocyclopentyl]-2-methoxy-5-methylbenzamide |
|---|---|
| PubChem CID | 99777899 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | N-[(1R,3R)-3-cyanocyclopentyl]-2-methoxy-5-methylbenzamide |
| SMILES | COc1ccc(C)cc1C(=O)N[C@@H]1CC[C@@H](C#N)C1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-3-6-14(19-2)13(7-10)15(18)17-12-5-4-11(8-12)9-16/h3,6-7,11-12H,4-5,8H2,1-2H3,(H,17,18)/t11-,12-/m1/s1 |
| InChIKey | PRQGLPWSRPLGND-VXGBXAGGSA-N |
| XLogP | 2.43 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |