C20H27N3O6 — CID 175962164
methyl (2S)-6-[[(1S,3S)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 175962164) has the molecular formula C20H27N3O6 and a molecular weight of 405.45 g/mol. Its IUPAC name is methyl (2S)-6-[[(1S,3S)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl (2S)-6-[[(1S,3S)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 175962164 |
| Molecular Formula | C20H27N3O6 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | methyl (2S)-6-[[(1S,3S)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@H](Nc2ccc3c(c2[N+](=O)[O-])CC[C@H](C)N3C(=O)OC)C1 |
| InChI | InChI=1S/C20H27N3O6/c1-12-7-8-15-17(22(12)20(25)29-3)10-9-16(18(15)23(26)27)21-14-6-4-5-13(11-14)19(24)28-2/h9-10,12-14,21H,4-8,11H2,1-3H3/t12-,13-,14-/m0/s1 |
| InChIKey | QMFDZKBLNVTPMO-IHRRRGAJSA-N |
| XLogP | 3.65 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|