C19H25N3O6 — CID 138472677
(2S)-6-[[(1R,3R)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylic acid (PubChem CID 138472677) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is (2S)-6-[[(1R,3R)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylic acid.
| Compound Name | (2S)-6-[[(1R,3R)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 138472677 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S)-6-[[(1R,3R)-3-methoxycarbonylcyclohexyl]amino]-2-methyl-5-nitro-3,4-dihydro-2H-quinoline-1-carboxylic acid |
| SMILES | COC(=O)[C@@H]1CCC[C@@H](Nc2ccc3c(c2[N+](=O)[O-])CC[C@H](C)N3C(=O)O)C1 |
| InChI | InChI=1S/C19H25N3O6/c1-11-6-7-14-16(21(11)19(24)25)9-8-15(17(14)22(26)27)20-13-5-3-4-12(10-13)18(23)28-2/h8-9,11-13,20H,3-7,10H2,1-2H3,(H,24,25)/t11-,12+,13+/m0/s1 |
| InChIKey | CSDMBZFCUYHNEU-YNEHKIRRSA-N |
| XLogP | 3.56 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|