C17H25N3O4S — CID 138479538
methyl (2S)-5-amino-6-[(1,1-dioxothian-3-yl)amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 138479538) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is methyl (2S)-5-amino-6-[(1,1-dioxothian-3-yl)amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | methyl (2S)-5-amino-6-[(1,1-dioxothian-3-yl)amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 138479538 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | methyl (2S)-5-amino-6-[(1,1-dioxothian-3-yl)amino]-2-methyl-3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | COC(=O)N1c2ccc(NC3CCCS(=O)(=O)C3)c(N)c2CC[C@@H]1C |
| InChI | InChI=1S/C17H25N3O4S/c1-11-5-6-13-15(20(11)17(21)24-2)8-7-14(16(13)18)19-12-4-3-9-25(22,23)10-12/h7-8,11-12,19H,3-6,9-10,18H2,1-2H3/t11-,12?/m0/s1 |
| InChIKey | UDEOBVAMWAYQHI-PXYINDEMSA-N |
| XLogP | 2.17 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|