C13H18N2O3S2 — CID 63922815
2-[2-[(1,1-dioxothian-3-yl)amino]phenyl]sulfanylacetamide (PubChem CID 63922815) has the molecular formula C13H18N2O3S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 2-[2-[(1,1-dioxothian-3-yl)amino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[(1,1-dioxothian-3-yl)amino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 63922815 |
| Molecular Formula | C13H18N2O3S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-[2-[(1,1-dioxothian-3-yl)amino]phenyl]sulfanylacetamide |
| SMILES | NC(=O)CSc1ccccc1NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N2O3S2/c14-13(16)8-19-12-6-2-1-5-11(12)15-10-4-3-7-20(17,18)9-10/h1-2,5-6,10,15H,3-4,7-9H2,(H2,14,16) |
| InChIKey | TVYAGFJWLFQHCI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |