C15H20N2O3S — CID 63911652
1-[5-[(1,1-dioxothian-3-yl)amino]-2,3-dihydroindol-1-yl]ethanone (PubChem CID 63911652) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[5-[(1,1-dioxothian-3-yl)amino]-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-[(1,1-dioxothian-3-yl)amino]-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 63911652 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-[5-[(1,1-dioxothian-3-yl)amino]-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(NC3CCCS(=O)(=O)C3)ccc21 |
| InChI | InChI=1S/C15H20N2O3S/c1-11(18)17-7-6-12-9-13(4-5-15(12)17)16-14-3-2-8-21(19,20)10-14/h4-5,9,14,16H,2-3,6-8,10H2,1H3 |
| InChIKey | ORJNBVQCQCZWFX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |