C16H23N3O — CID 100685883
(8aS)-7-[(3S)-3-phenylbutyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 100685883) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is (8aS)-7-[(3S)-3-phenylbutyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | (8aS)-7-[(3S)-3-phenylbutyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 100685883 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | (8aS)-7-[(3S)-3-phenylbutyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | C[C@@H](CCN1CCN2C(=O)NC[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C16H23N3O/c1-13(14-5-3-2-4-6-14)7-8-18-9-10-19-15(12-18)11-17-16(19)20/h2-6,13,15H,7-12H2,1H3,(H,17,20)/t13-,15-/m0/s1 |
| InChIKey | MEMUXWHMRHTWFB-ZFWWWQNUSA-N |
| XLogP | 1.89 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |