C16H24N2O — CID 42464655
4-methyl-1-[(3S)-3-phenylbutyl]-1,4-diazepan-5-one (PubChem CID 42464655) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 4-methyl-1-[(3S)-3-phenylbutyl]-1,4-diazepan-5-one.
| Compound Name | 4-methyl-1-[(3S)-3-phenylbutyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42464655 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 4-methyl-1-[(3S)-3-phenylbutyl]-1,4-diazepan-5-one |
| SMILES | C[C@@H](CCN1CCC(=O)N(C)CC1)c1ccccc1 |
| InChI | InChI=1S/C16H24N2O/c1-14(15-6-4-3-5-7-15)8-10-18-11-9-16(19)17(2)12-13-18/h3-7,14H,8-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | APKLXAOHNFRYTB-AWEZNQCLSA-N |
| XLogP | 2.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |