C17H19FN6O2 — CID 100686000
1-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-N-(3-pyrazol-1-ylpropyl)triazole-4-carboxamide (PubChem CID 100686000) has the molecular formula C17H19FN6O2 and a molecular weight of 358.38 g/mol. Its IUPAC name is 1-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-N-(3-pyrazol-1-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-N-(3-pyrazol-1-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 100686000 |
| Molecular Formula | C17H19FN6O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[(2R)-2-(2-fluorophenyl)-2-hydroxyethyl]-N-(3-pyrazol-1-ylpropyl)triazole-4-carboxamide |
| SMILES | O=C(NCCCn1cccn1)c1cn(C[C@H](O)c2ccccc2F)nn1 |
| InChI | InChI=1S/C17H19FN6O2/c18-14-6-2-1-5-13(14)16(25)12-24-11-15(21-22-24)17(26)19-7-3-9-23-10-4-8-20-23/h1-2,4-6,8,10-11,16,25H,3,7,9,12H2,(H,19,26)/t16-/m0/s1 |
| InChIKey | UZKGAXOLNOFXKV-INIZCTEOSA-N |
| XLogP | 1.17 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|