C20H29N3O2 — CID 100686105
(5R)-8-methoxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 100686105) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (5R)-8-methoxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | (5R)-8-methoxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 100686105 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (5R)-8-methoxy-N-[3-(1,3,5-trimethylpyrazol-4-yl)propyl]-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | COc1ccc2c(c1)OCCC[C@H]2NCCCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C20H29N3O2/c1-14-17(15(2)23(3)22-14)7-5-11-21-19-8-6-12-25-20-13-16(24-4)9-10-18(19)20/h9-10,13,19,21H,5-8,11-12H2,1-4H3/t19-/m1/s1 |
| InChIKey | KSRMZBZGRAICIK-LJQANCHMSA-N |
| XLogP | 3.48 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|