C11H11ClN2O2S — CID 100686773
2-(3-chlorophenyl)-5-(ethoxymethylsulfanyl)-1,3,4-oxadiazole (PubChem CID 100686773) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-5-(ethoxymethylsulfanyl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chlorophenyl)-5-(ethoxymethylsulfanyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 100686773 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-(3-chlorophenyl)-5-(ethoxymethylsulfanyl)-1,3,4-oxadiazole |
| SMILES | CCOCSc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C11H11ClN2O2S/c1-2-15-7-17-11-14-13-10(16-11)8-4-3-5-9(12)6-8/h3-6H,2,7H2,1H3 |
| InChIKey | JHLGNFAWVQZZRB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|