C11H8ClN3OS — CID 7533885
3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanenitrile (PubChem CID 7533885) has the molecular formula C11H8ClN3OS and a molecular weight of 265.73 g/mol. Its IUPAC name is 3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 7533885 |
| Molecular Formula | C11H8ClN3OS |
| Molecular Weight | 265.73 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 3-[[5-(3-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanenitrile |
| SMILES | N#CCCSc1nnc(-c2cccc(Cl)c2)o1 |
| InChI | InChI=1S/C11H8ClN3OS/c12-9-4-1-3-8(7-9)10-14-15-11(16-10)17-6-2-5-13/h1,3-4,7H,2,6H2 |
| InChIKey | YPMSHCDGNSFWRG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.73 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|