C8H15N3OS — CID 100686943
3-(ethoxymethylsulfanyl)-5-ethyl-4-methyl-1,2,4-triazole (PubChem CID 100686943) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-(ethoxymethylsulfanyl)-5-ethyl-4-methyl-1,2,4-triazole.
| Compound Name | 3-(ethoxymethylsulfanyl)-5-ethyl-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 100686943 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 3-(ethoxymethylsulfanyl)-5-ethyl-4-methyl-1,2,4-triazole |
| SMILES | CCOCSc1nnc(CC)n1C |
| InChI | InChI=1S/C8H15N3OS/c1-4-7-9-10-8(11(7)3)13-6-12-5-2/h4-6H2,1-3H3 |
| InChIKey | KXTQHCHQBVIFQC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|