About (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol
(5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol (PubChem CID 126994903) has the molecular formula C6H11N3OS
and a molecular weight of 173.24 g/mol. Its IUPAC name is (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol.
Analyze (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol?
The IUPAC name of (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol (CID 126994903) is (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol.
What is the SMILES notation for (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol?
The canonical SMILES for (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol is CCSc1nnc(CO)n1C.
What is the InChIKey of (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol?
The InChIKey is LKTLWWJRTHLQRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3OS/c1-3-11-6-8-7-5(4-10)9(6)2/h10H,3-4H2,1-2H3.
What are the key properties of (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol?
(5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol has a molecular weight of 173.24 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-ethylsulfanyl-4-methyl-1,2,4-triazol-3-yl)methanol is sourced from PubChem (CID 126994903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).