C9H8BrN5O3S — CID 133385433
[5-[(3-bromo-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanol (PubChem CID 133385433) has the molecular formula C9H8BrN5O3S and a molecular weight of 346.17 g/mol. Its IUPAC name is [5-[(3-bromo-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[(3-bromo-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 133385433 |
| Molecular Formula | C9H8BrN5O3S |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | [5-[(3-bromo-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanol |
| SMILES | Cn1c(CO)nnc1Sc1ncc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C9H8BrN5O3S/c1-14-7(4-16)12-13-9(14)19-8-6(10)2-5(3-11-8)15(17)18/h2-3,16H,4H2,1H3 |
| InChIKey | NKZCRQGHEHELSN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|