C16H16N6O3S — CID 133385417
[5-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methanol (PubChem CID 133385417) has the molecular formula C16H16N6O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is [5-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 133385417 |
| Molecular Formula | C16H16N6O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | [5-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]sulfanyl-4-methyl-1,2,4-triazol-3-yl]methanol |
| SMILES | CCc1cc(Sc2nnc(CO)n2C)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C16H16N6O3S/c1-3-11-8-14(26-16-20-19-13(9-23)21(16)2)18-15(17-11)10-4-6-12(7-5-10)22(24)25/h4-8,23H,3,9H2,1-2H3 |
| InChIKey | OFBRSQIMTUPQBV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|