C20H29N5O3 — CID 100670022
(2R)-4-(diethylamino)-2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol (PubChem CID 100670022) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (2R)-4-(diethylamino)-2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol.
| Compound Name | (2R)-4-(diethylamino)-2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 100670022 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | (2R)-4-(diethylamino)-2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]butan-1-ol |
| SMILES | CCc1cc(N[C@@H](CO)CCN(CC)CC)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H29N5O3/c1-4-16-13-19(21-17(14-26)11-12-24(5-2)6-3)23-20(22-16)15-7-9-18(10-8-15)25(27)28/h7-10,13,17,26H,4-6,11-12,14H2,1-3H3,(H,21,22,23)/t17-/m1/s1 |
| InChIKey | OFSWBDQBBJUCTQ-QGZVFWFLSA-N |
| XLogP | 3.12 |
| TPSA | 104.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|