C20H19FN4O3 — CID 60567641
2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1-(2-fluorophenyl)ethanol (PubChem CID 60567641) has the molecular formula C20H19FN4O3 and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1-(2-fluorophenyl)ethanol.
| Compound Name | 2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1-(2-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 60567641 |
| Molecular Formula | C20H19FN4O3 |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-1-(2-fluorophenyl)ethanol |
| SMILES | CCc1cc(NCC(O)c2ccccc2F)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C20H19FN4O3/c1-2-14-11-19(22-12-18(26)16-5-3-4-6-17(16)21)24-20(23-14)13-7-9-15(10-8-13)25(27)28/h3-11,18,26H,2,12H2,1H3,(H,22,23,24) |
| InChIKey | IBRWLGRBIPGSCU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|