C17H17N5O3 — CID 133278074
2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-N-prop-2-ynylacetamide (PubChem CID 133278074) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-N-prop-2-ynylacetamide.
| Compound Name | 2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 133278074 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]amino]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)CNc1cc(CC)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C17H17N5O3/c1-3-9-18-16(23)11-19-15-10-13(4-2)20-17(21-15)12-5-7-14(8-6-12)22(24)25/h1,5-8,10H,4,9,11H2,2H3,(H,18,23)(H,19,20,21) |
| InChIKey | ZHZVAQOUJXBFQP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|