C18H19N5O2S — CID 133326094
6-ethyl-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-(4-nitrophenyl)pyrimidin-4-amine (PubChem CID 133326094) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 6-ethyl-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-(4-nitrophenyl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-(4-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133326094 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 6-ethyl-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-(4-nitrophenyl)pyrimidin-4-amine |
| SMILES | CCc1cc(NCc2ncc(CC)s2)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H19N5O2S/c1-3-13-9-16(19-11-17-20-10-15(4-2)26-17)22-18(21-13)12-5-7-14(8-6-12)23(24)25/h5-10H,3-4,11H2,1-2H3,(H,19,21,22) |
| InChIKey | ASXOOFSQMBBFTO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|