C21H24N6O2 — CID 133386171
N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-ethyl-2-(4-nitrophenyl)pyrimidin-4-amine (PubChem CID 133386171) has the molecular formula C21H24N6O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-ethyl-2-(4-nitrophenyl)pyrimidin-4-amine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-ethyl-2-(4-nitrophenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133386171 |
| Molecular Formula | C21H24N6O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]-6-ethyl-2-(4-nitrophenyl)pyrimidin-4-amine |
| SMILES | CCc1cc(NCc2ccn(C3CCCC3)n2)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H24N6O2/c1-2-16-13-20(22-14-17-11-12-26(25-17)18-5-3-4-6-18)24-21(23-16)15-7-9-19(10-8-15)27(28)29/h7-13,18H,2-6,14H2,1H3,(H,22,23,24) |
| InChIKey | GNWRQOOYWUPXRQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|