C19H21N7O2 — CID 133279796
4-ethyl-2-(4-nitrophenyl)-6-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]pyrimidine (PubChem CID 133279796) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 4-ethyl-2-(4-nitrophenyl)-6-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]pyrimidine.
| Compound Name | 4-ethyl-2-(4-nitrophenyl)-6-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133279796 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 4-ethyl-2-(4-nitrophenyl)-6-[4-(1,2,4-triazol-1-yl)piperidin-1-yl]pyrimidine |
| SMILES | CCc1cc(N2CCC(n3cncn3)CC2)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C19H21N7O2/c1-2-15-11-18(24-9-7-16(8-10-24)25-13-20-12-21-25)23-19(22-15)14-3-5-17(6-4-14)26(27)28/h3-6,11-13,16H,2,7-10H2,1H3 |
| InChIKey | OCWNVGQNNSNOEI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|