C18H24N6O4S — CID 52519796
4-ethyl-2-(4-nitrophenyl)-6-[(3R)-3-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine (PubChem CID 52519796) has the molecular formula C18H24N6O4S and a molecular weight of 420.50 g/mol. Its IUPAC name is 4-ethyl-2-(4-nitrophenyl)-6-[(3R)-3-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine.
| Compound Name | 4-ethyl-2-(4-nitrophenyl)-6-[(3R)-3-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 52519796 |
| Molecular Formula | C18H24N6O4S |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-ethyl-2-(4-nitrophenyl)-6-[(3R)-3-[(sulfamoylamino)methyl]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cc(N2CCC[C@@H](CNS(N)(=O)=O)C2)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C18H24N6O4S/c1-2-15-10-17(23-9-3-4-13(12-23)11-20-29(19,27)28)22-18(21-15)14-5-7-16(8-6-14)24(25)26/h5-8,10,13,20H,2-4,9,11-12H2,1H3,(H2,19,27,28)/t13-/m0/s1 |
| InChIKey | OXPWPZBVTGGFSR-ZDUSSCGKSA-N |
| XLogP | 1.62 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|