C21H25N5O3 — CID 133499058
cyclopropyl-[4-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone (PubChem CID 133499058) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is cyclopropyl-[4-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 133499058 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | cyclopropyl-[4-[6-ethyl-2-(4-nitrophenyl)pyrimidin-4-yl]-1,4-diazepan-1-yl]methanone |
| SMILES | CCc1cc(N2CCCN(C(=O)C3CC3)CC2)nc(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H25N5O3/c1-2-17-14-19(23-20(22-17)15-6-8-18(9-7-15)26(28)29)24-10-3-11-25(13-12-24)21(27)16-4-5-16/h6-9,14,16H,2-5,10-13H2,1H3 |
| InChIKey | IXDOPZBEBJJXFG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|