C17H26N4O2 — CID 100687236
1-[(3R)-hex-5-en-3-yl]-3-(4-pyrazin-2-yloxycyclohexyl)urea (PubChem CID 100687236) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[(3R)-hex-5-en-3-yl]-3-(4-pyrazin-2-yloxycyclohexyl)urea.
| Compound Name | 1-[(3R)-hex-5-en-3-yl]-3-(4-pyrazin-2-yloxycyclohexyl)urea |
|---|---|
| PubChem CID | 100687236 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[(3R)-hex-5-en-3-yl]-3-(4-pyrazin-2-yloxycyclohexyl)urea |
| SMILES | C=CC[C@@H](CC)NC(=O)NC1CCC(Oc2cnccn2)CC1 |
| InChI | InChI=1S/C17H26N4O2/c1-3-5-13(4-2)20-17(22)21-14-6-8-15(9-7-14)23-16-12-18-10-11-19-16/h3,10-15H,1,4-9H2,2H3,(H2,20,21,22)/t13-,14?,15?/m1/s1 |
| InChIKey | XEJUWVNVVQWTPL-WLYUNCDWSA-N |
| XLogP | 2.82 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|