C13H16F3NO2 — CID 100688491
N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-2,2,2-trifluoroacetamide (PubChem CID 100688491) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 100688491 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[4-[(2R)-butan-2-yl]oxy-3-methylphenyl]-2,2,2-trifluoroacetamide |
| SMILES | CC[C@@H](C)Oc1ccc(NC(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H16F3NO2/c1-4-9(3)19-11-6-5-10(7-8(11)2)17-12(18)13(14,15)16/h5-7,9H,4H2,1-3H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | IWIQHPAYKKHTNL-SECBINFHSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |