C20H24N2O3S — CID 100688665
N-[(1R,2S,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-propylthiophene-3-carboxamide (PubChem CID 100688665) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[(1R,2S,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-propylthiophene-3-carboxamide.
| Compound Name | N-[(1R,2S,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 100688665 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(1R,2S,6R,7S)-3,5-dioxo-10-propan-2-ylidene-4-azatricyclo[5.2.1.02,6]decan-4-yl]-5-propylthiophene-3-carboxamide |
| SMILES | CCCc1cc(C(=O)NN2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2CC[C@H]3C2=C(C)C)cs1 |
| InChI | InChI=1S/C20H24N2O3S/c1-4-5-12-8-11(9-26-12)18(23)21-22-19(24)16-13-6-7-14(15(13)10(2)3)17(16)20(22)25/h8-9,13-14,16-17H,4-7H2,1-3H3,(H,21,23)/t13-,14+,16-,17+ |
| InChIKey | WBIFOAGBBDIHQZ-MDBPOYHNSA-N |
| XLogP | 3.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|