C16H18N2O4S — CID 98290262
N-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-5-propylthiophene-3-carboxamide (PubChem CID 98290262) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-5-propylthiophene-3-carboxamide.
| Compound Name | N-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-5-propylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 98290262 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[(3aR,4S,7S,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl]-5-propylthiophene-3-carboxamide |
| SMILES | CCCc1cc(C(=O)NN2C(=O)[C@@H]3[C@@H](C2=O)[C@@H]2CC[C@@H]3O2)cs1 |
| InChI | InChI=1S/C16H18N2O4S/c1-2-3-9-6-8(7-23-9)14(19)17-18-15(20)12-10-4-5-11(22-10)13(12)16(18)21/h6-7,10-13H,2-5H2,1H3,(H,17,19)/t10-,11-,12-,13-/m0/s1 |
| InChIKey | GOQSIEOMOYVZKK-CYDGBPFRSA-N |
| XLogP | 1.51 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|