C17H18N2O3S — CID 98293988
N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-5-propan-2-ylthiophene-3-carboxamide (PubChem CID 98293988) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-5-propan-2-ylthiophene-3-carboxamide.
| Compound Name | N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-5-propan-2-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 98293988 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | N-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-5-propan-2-ylthiophene-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NN2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)cs1 |
| InChI | InChI=1S/C17H18N2O3S/c1-8(2)12-6-11(7-23-12)15(20)18-19-16(21)13-9-3-4-10(5-9)14(13)17(19)22/h3-4,6-10,13-14H,5H2,1-2H3,(H,18,20)/t9-,10-,13-,14+/m0/s1 |
| InChIKey | FJKQYGRTKJGUGS-TXFQPVFDSA-N |
| XLogP | 2.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|