C13H22N2O3S — CID 100690689
1-[(1,1-dioxothian-4-yl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea (PubChem CID 100690689) has the molecular formula C13H22N2O3S and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea.
| Compound Name | 1-[(1,1-dioxothian-4-yl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea |
|---|---|
| PubChem CID | 100690689 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)methyl]-3-[(3R)-4-methylpent-1-yn-3-yl]urea |
| SMILES | C#C[C@H](NC(=O)NCC1CCS(=O)(=O)CC1)C(C)C |
| InChI | InChI=1S/C13H22N2O3S/c1-4-12(10(2)3)15-13(16)14-9-11-5-7-19(17,18)8-6-11/h1,10-12H,5-9H2,2-3H3,(H2,14,15,16)/t12-/m0/s1 |
| InChIKey | PCNWOPDFZBDUDF-LBPRGKRZSA-N |
| XLogP | 0.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|