C15H19F2N3O2 — CID 100690740
1-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]-3-[(3S)-4-methylpent-1-yn-3-yl]urea (PubChem CID 100690740) has the molecular formula C15H19F2N3O2 and a molecular weight of 311.33 g/mol. Its IUPAC name is 1-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]-3-[(3S)-4-methylpent-1-yn-3-yl]urea.
| Compound Name | 1-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]-3-[(3S)-4-methylpent-1-yn-3-yl]urea |
|---|---|
| PubChem CID | 100690740 |
| Molecular Formula | C15H19F2N3O2 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 1-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methyl]-3-[(3S)-4-methylpent-1-yn-3-yl]urea |
| SMILES | C#C[C@@H](NC(=O)NCc1cccnc1OCC(F)F)C(C)C |
| InChI | InChI=1S/C15H19F2N3O2/c1-4-12(10(2)3)20-15(21)19-8-11-6-5-7-18-14(11)22-9-13(16)17/h1,5-7,10,12-13H,8-9H2,2-3H3,(H2,19,20,21)/t12-/m1/s1 |
| InChIKey | BXXVJRANRXRNKW-GFCCVEGCSA-N |
| XLogP | 2.18 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|