C15H19F2N3O3 — CID 167886364
N-[2-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 167886364) has the molecular formula C15H19F2N3O3 and a molecular weight of 327.33 g/mol. Its IUPAC name is N-[2-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | N-[2-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 167886364 |
| Molecular Formula | C15H19F2N3O3 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | N-[2-[[2-(2,2-difluoroethoxy)-3-pyridinyl]methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)NCc1cccnc1OCC(F)F |
| InChI | InChI=1S/C15H19F2N3O3/c1-3-14(22)20(4-2)9-13(21)19-8-11-6-5-7-18-15(11)23-10-12(16)17/h3,5-7,12H,1,4,8-10H2,2H3,(H,19,21) |
| InChIKey | OBLDYKPDNRLUQC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|