C17H19FN2O2S — CID 37487153
N-[(2-ethoxy-3-pyridinyl)methyl]-3-(2-fluorophenyl)sulfanylpropanamide (PubChem CID 37487153) has the molecular formula C17H19FN2O2S and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(2-ethoxy-3-pyridinyl)methyl]-3-(2-fluorophenyl)sulfanylpropanamide.
| Compound Name | N-[(2-ethoxy-3-pyridinyl)methyl]-3-(2-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 37487153 |
| Molecular Formula | C17H19FN2O2S |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[(2-ethoxy-3-pyridinyl)methyl]-3-(2-fluorophenyl)sulfanylpropanamide |
| SMILES | CCOc1ncccc1CNC(=O)CCSc1ccccc1F |
| InChI | InChI=1S/C17H19FN2O2S/c1-2-22-17-13(6-5-10-19-17)12-20-16(21)9-11-23-15-8-4-3-7-14(15)18/h3-8,10H,2,9,11-12H2,1H3,(H,20,21) |
| InChIKey | XMKCHOJTZNRRAK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |