C17H27N3O3 — CID 37486928
N-[4-[(2-ethoxy-3-pyridinyl)methylamino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 37486928) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[4-[(2-ethoxy-3-pyridinyl)methylamino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[(2-ethoxy-3-pyridinyl)methylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 37486928 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[4-[(2-ethoxy-3-pyridinyl)methylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | CCOc1ncccc1CNC(=O)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H27N3O3/c1-5-23-15-13(8-6-10-18-15)12-20-14(21)9-7-11-19-16(22)17(2,3)4/h6,8,10H,5,7,9,11-12H2,1-4H3,(H,19,22)(H,20,21) |
| InChIKey | ORDVEAFTUNFFEH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|