C16H19ClN4O2 — CID 166407679
N-[2-[(7-chloro-1-methylbenzimidazol-2-yl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide (PubChem CID 166407679) has the molecular formula C16H19ClN4O2 and a molecular weight of 334.81 g/mol. Its IUPAC name is N-[2-[(7-chloro-1-methylbenzimidazol-2-yl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide.
| Compound Name | N-[2-[(7-chloro-1-methylbenzimidazol-2-yl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
|---|---|
| PubChem CID | 166407679 |
| Molecular Formula | C16H19ClN4O2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[2-[(7-chloro-1-methylbenzimidazol-2-yl)methylamino]-2-oxoethyl]-N-ethylprop-2-enamide |
| SMILES | C=CC(=O)N(CC)CC(=O)NCc1nc2cccc(Cl)c2n1C |
| InChI | InChI=1S/C16H19ClN4O2/c1-4-15(23)21(5-2)10-14(22)18-9-13-19-12-8-6-7-11(17)16(12)20(13)3/h4,6-8H,1,5,9-10H2,2-3H3,(H,18,22) |
| InChIKey | DGJWMGWNBSEVON-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|