C17H25F3IN5O3 — CID 111163542
ethyl 4-[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111163542) has the molecular formula C17H25F3IN5O3 and a molecular weight of 531.32 g/mol. Its IUPAC name is ethyl 4-[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111163542 |
| Molecular Formula | C17H25F3IN5O3 |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | ethyl 4-[N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCc2cccnc2OCC(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H24F3N5O3.HI/c1-3-27-16(26)25-9-7-24(8-10-25)15(21-2)23-11-13-5-4-6-22-14(13)28-12-17(18,19)20;/h4-6H,3,7-12H2,1-2H3,(H,21,23);1H |
| InChIKey | BFENJAHBDKDRJZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|