C17H26F3IN4O2 — CID 111959802
4-ethoxy-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111959802) has the molecular formula C17H26F3IN4O2 and a molecular weight of 502.32 g/mol. Its IUPAC name is 4-ethoxy-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | 4-ethoxy-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111959802 |
| Molecular Formula | C17H26F3IN4O2 |
| Molecular Weight | 502.32 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | 4-ethoxy-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCOC1CCN(/C(=N/C)NCc2cccnc2OCC(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H25F3N4O2.HI/c1-3-25-14-6-9-24(10-7-14)16(21-2)23-11-13-5-4-8-22-15(13)26-12-17(18,19)20;/h4-5,8,14H,3,6-7,9-12H2,1-2H3,(H,21,23);1H |
| InChIKey | CLEJNEQROBEQQK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|