C16H23F3N4OS — CID 109488885
N',2,2-trimethyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 109488885) has the molecular formula C16H23F3N4OS and a molecular weight of 376.45 g/mol. Its IUPAC name is N',2,2-trimethyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N',2,2-trimethyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109488885 |
| Molecular Formula | C16H23F3N4OS |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N',2,2-trimethyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | C/N=C(\NCc1cccnc1OCC(F)(F)F)N1CCSC(C)(C)C1 |
| InChI | InChI=1S/C16H23F3N4OS/c1-15(2)10-23(7-8-25-15)14(20-3)22-9-12-5-4-6-21-13(12)24-11-16(17,18)19/h4-6H,7-11H2,1-3H3,(H,20,22) |
| InChIKey | ZQUKKYKDURJUPZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|