C18H27F3N4O3 — CID 111746537
3-(2-methoxyethoxymethyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 111746537) has the molecular formula C18H27F3N4O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111746537 |
| Molecular Formula | C18H27F3N4O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-N'-methyl-N-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(/NCc1cccnc1OCC(F)(F)F)N1CCC(COCCOC)C1 |
| InChI | InChI=1S/C18H27F3N4O3/c1-22-17(25-7-5-14(11-25)12-27-9-8-26-2)24-10-15-4-3-6-23-16(15)28-13-18(19,20)21/h3-4,6,14H,5,7-13H2,1-2H3,(H,22,24) |
| InChIKey | WAQIUNJGVLTHMR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|