C19H29BrN2O2 — CID 100691005
2-bromo-N-[4-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethoxy]phenyl]-2-methylpropanamide (PubChem CID 100691005) has the molecular formula C19H29BrN2O2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 2-bromo-N-[4-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethoxy]phenyl]-2-methylpropanamide.
| Compound Name | 2-bromo-N-[4-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethoxy]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 100691005 |
| Molecular Formula | C19H29BrN2O2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-bromo-N-[4-[2-[(3S,5R)-3,5-dimethylpiperidin-1-yl]ethoxy]phenyl]-2-methylpropanamide |
| SMILES | C[C@@H]1C[C@H](C)CN(CCOc2ccc(NC(=O)C(C)(C)Br)cc2)C1 |
| InChI | InChI=1S/C19H29BrN2O2/c1-14-11-15(2)13-22(12-14)9-10-24-17-7-5-16(6-8-17)21-18(23)19(3,4)20/h5-8,14-15H,9-13H2,1-4H3,(H,21,23)/t14-,15+ |
| InChIKey | BQMPVJFUGXWTTB-GASCZTMLSA-N |
| XLogP | 4.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|