C30H28N2O3S — CID 100691321
N-[(Z)-3-[[(S)-(2,4-dimethylphenyl)-phenylmethyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 100691321) has the molecular formula C30H28N2O3S and a molecular weight of 496.63 g/mol. Its IUPAC name is N-[(Z)-3-[[(S)-(2,4-dimethylphenyl)-phenylmethyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(Z)-3-[[(S)-(2,4-dimethylphenyl)-phenylmethyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 100691321 |
| Molecular Formula | C30H28N2O3S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[(Z)-3-[[(S)-(2,4-dimethylphenyl)-phenylmethyl]amino]-3-oxo-1-thiophen-2-ylprop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N/C(=C\c2cccs2)C(=O)N[C@@H](c2ccccc2)c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C30H28N2O3S/c1-20-11-16-26(21(2)18-20)28(22-8-5-4-6-9-22)32-30(34)27(19-25-10-7-17-36-25)31-29(33)23-12-14-24(35-3)15-13-23/h4-19,28H,1-3H3,(H,31,33)(H,32,34)/b27-19-/t28-/m0/s1 |
| InChIKey | VISVNKUNPKNKDW-PQPBAKKCSA-N |
| XLogP | 6.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|