C29H31Cl4N3O4S — CID 100692562
(2R)-N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide (PubChem CID 100692562) has the molecular formula C29H31Cl4N3O4S and a molecular weight of 659.46 g/mol. Its IUPAC name is (2R)-N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100692562 |
| Molecular Formula | C29H31Cl4N3O4S |
| Molecular Weight | 659.46 g/mol |
| Exact Mass | 657.08 |
| IUPAC Name | (2R)-N-butyl-2-[[2-(2,3-dichloro-N-methylsulfonylanilino)acetyl]-[(3,4-dichlorophenyl)methyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cccc(Cl)c1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C29H31Cl4N3O4S/c1-3-4-15-34-29(38)26(17-20-9-6-5-7-10-20)35(18-21-13-14-22(30)24(32)16-21)27(37)19-36(41(2,39)40)25-12-8-11-23(31)28(25)33/h5-14,16,26H,3-4,15,17-19H2,1-2H3,(H,34,38)/t26-/m1/s1 |
| InChIKey | AERPDAQCKNEOOW-AREMUKBSSA-N |
| XLogP | 6.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.46 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|