C29H30Cl5N3O4S — CID 100702483
(2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100702483) has the molecular formula C29H30Cl5N3O4S and a molecular weight of 693.91 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100702483 |
| Molecular Formula | C29H30Cl5N3O4S |
| Molecular Weight | 693.91 g/mol |
| Exact Mass | 691.04 |
| IUPAC Name | (2S)-N-butyl-2-[(2,6-dichlorophenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C29H30Cl5N3O4S/c1-3-4-13-35-29(39)27(14-19-9-6-5-7-10-19)36(17-20-21(30)11-8-12-22(20)31)28(38)18-37(42(2,40)41)26-16-24(33)23(32)15-25(26)34/h5-12,15-16,27H,3-4,13-14,17-18H2,1-2H3,(H,35,39)/t27-/m0/s1 |
| InChIKey | QREDYCRDDQBRDH-MHZLTWQESA-N |
| XLogP | 7.28 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|