C17H21N5O2 — CID 100693036
2-[[3-[(3S,5R)-3,5-dimethylcyclohexyl]-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 100693036) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-[[3-[(3S,5R)-3,5-dimethylcyclohexyl]-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[[3-[(3S,5R)-3,5-dimethylcyclohexyl]-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 100693036 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-[[3-[(3S,5R)-3,5-dimethylcyclohexyl]-1,2,4-oxadiazol-5-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | C[C@@H]1CC(c2noc(Cn3nc4ccccn4c3=O)n2)C[C@H](C)C1 |
| InChI | InChI=1S/C17H21N5O2/c1-11-7-12(2)9-13(8-11)16-18-15(24-20-16)10-22-17(23)21-6-4-3-5-14(21)19-22/h3-6,11-13H,7-10H2,1-2H3/t11-,12+,13? |
| InChIKey | ICNQCVAFRKAPSP-FUNVUKJBSA-N |
| XLogP | 2.47 |
| TPSA | 78.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |